C20H38N2O2 — CID 158335840
4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-1-(2-piperidin-1-ylethyl)piperidine (PubChem CID 158335840) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-1-(2-piperidin-1-ylethyl)piperidine.
| Compound Name | 4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-1-(2-piperidin-1-ylethyl)piperidine |
|---|---|
| PubChem CID | 158335840 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | 4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-1-(2-piperidin-1-ylethyl)piperidine |
| SMILES | CC(C)(C)OC1CC(OC2CCN(CCN3CCCCC3)CC2)C1 |
| InChI | InChI=1S/C20H38N2O2/c1-20(2,3)24-19-15-18(16-19)23-17-7-11-22(12-8-17)14-13-21-9-5-4-6-10-21/h17-19H,4-16H2,1-3H3 |
| InChIKey | RQKACHICGFSIST-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |