C16H16N2O8 — CID 134489839
methyl (Z)-2-hydroxy-4-[4-[[(E)-3-hydroxy-4-methoxy-4-oxobut-2-enoyl]amino]anilino]-4-oxobut-2-enoate (PubChem CID 134489839) has the molecular formula C16H16N2O8 and a molecular weight of 364.31 g/mol. Its IUPAC name is methyl (Z)-2-hydroxy-4-[4-[[(E)-3-hydroxy-4-methoxy-4-oxobut-2-enoyl]amino]anilino]-4-oxobut-2-enoate.
| Compound Name | methyl (Z)-2-hydroxy-4-[4-[[(E)-3-hydroxy-4-methoxy-4-oxobut-2-enoyl]amino]anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 134489839 |
| Molecular Formula | C16H16N2O8 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | methyl (Z)-2-hydroxy-4-[4-[[(E)-3-hydroxy-4-methoxy-4-oxobut-2-enoyl]amino]anilino]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C(O)=C/C(=O)Nc1ccc(NC(=O)/C=C(/O)C(=O)OC)cc1 |
| InChI | InChI=1S/C16H16N2O8/c1-25-15(23)11(19)7-13(21)17-9-3-5-10(6-4-9)18-14(22)8-12(20)16(24)26-2/h3-8,19-20H,1-2H3,(H,17,21)(H,18,22)/b11-7-,12-8+ |
| InChIKey | XQRCDOWHLORNJW-NTLHZVPKSA-N |
| XLogP | 0.79 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|