C17H17NO7 — CID 159127009
methyl (E)-2-hydroxy-5-[4-[[(E)-3-hydroxy-4-oxopent-2-enoyl]amino]phenyl]-4-oxopent-2-enoate (PubChem CID 159127009) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is methyl (E)-2-hydroxy-5-[4-[[(E)-3-hydroxy-4-oxopent-2-enoyl]amino]phenyl]-4-oxopent-2-enoate.
| Compound Name | methyl (E)-2-hydroxy-5-[4-[[(E)-3-hydroxy-4-oxopent-2-enoyl]amino]phenyl]-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 159127009 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | methyl (E)-2-hydroxy-5-[4-[[(E)-3-hydroxy-4-oxopent-2-enoyl]amino]phenyl]-4-oxopent-2-enoate |
| SMILES | COC(=O)/C(O)=C\C(=O)Cc1ccc(NC(=O)/C=C(/O)C(C)=O)cc1 |
| InChI | InChI=1S/C17H17NO7/c1-10(19)14(21)9-16(23)18-12-5-3-11(4-6-12)7-13(20)8-15(22)17(24)25-2/h3-6,8-9,21-22H,7H2,1-2H3,(H,18,23)/b14-9+,15-8+ |
| InChIKey | ARBBAYDBNQBQDD-LPSKSUNQSA-N |
| XLogP | 1.38 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|