C23H27NO6 — CID 158635947
methyl (Z)-5-[4-[[(Z)-4-(3-methylcyclohexyl)oxy-4-oxobut-2-enoyl]amino]phenyl]-4-oxopent-2-enoate (PubChem CID 158635947) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl (Z)-5-[4-[[(Z)-4-(3-methylcyclohexyl)oxy-4-oxobut-2-enoyl]amino]phenyl]-4-oxopent-2-enoate.
| Compound Name | methyl (Z)-5-[4-[[(Z)-4-(3-methylcyclohexyl)oxy-4-oxobut-2-enoyl]amino]phenyl]-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 158635947 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | methyl (Z)-5-[4-[[(Z)-4-(3-methylcyclohexyl)oxy-4-oxobut-2-enoyl]amino]phenyl]-4-oxopent-2-enoate |
| SMILES | COC(=O)/C=C\C(=O)Cc1ccc(NC(=O)/C=C\C(=O)OC2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C23H27NO6/c1-16-4-3-5-20(14-16)30-23(28)13-11-21(26)24-18-8-6-17(7-9-18)15-19(25)10-12-22(27)29-2/h6-13,16,20H,3-5,14-15H2,1-2H3,(H,24,26)/b12-10-,13-11- |
| InChIKey | QJWSLZRHFJPFNI-MIMPSMLTSA-N |
| XLogP | 3.14 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|