C15H13NO5 — CID 157202015
(Z)-4-oxo-5-[4-[[(Z)-4-oxobut-2-enoyl]amino]phenyl]pent-2-enoic acid (PubChem CID 157202015) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is (Z)-4-oxo-5-[4-[[(Z)-4-oxobut-2-enoyl]amino]phenyl]pent-2-enoic acid.
| Compound Name | (Z)-4-oxo-5-[4-[[(Z)-4-oxobut-2-enoyl]amino]phenyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 157202015 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (Z)-4-oxo-5-[4-[[(Z)-4-oxobut-2-enoyl]amino]phenyl]pent-2-enoic acid |
| SMILES | O=C/C=C\C(=O)Nc1ccc(CC(=O)/C=C\C(=O)O)cc1 |
| InChI | InChI=1S/C15H13NO5/c17-9-1-2-14(19)16-12-5-3-11(4-6-12)10-13(18)7-8-15(20)21/h1-9H,10H2,(H,16,19)(H,20,21)/b2-1-,8-7- |
| InChIKey | SWVMUVZNTPFDRZ-QGTKBVGQSA-N |
| XLogP | 1.13 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|