C18H18N4O5 — CID 134490742
1-[[(3R)-4-(2-cyanoacetyl)morpholin-3-yl]methoxy]-7-hydroxyisoquinoline-6-carboxamide (PubChem CID 134490742) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-[[(3R)-4-(2-cyanoacetyl)morpholin-3-yl]methoxy]-7-hydroxyisoquinoline-6-carboxamide.
| Compound Name | 1-[[(3R)-4-(2-cyanoacetyl)morpholin-3-yl]methoxy]-7-hydroxyisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 134490742 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-[[(3R)-4-(2-cyanoacetyl)morpholin-3-yl]methoxy]-7-hydroxyisoquinoline-6-carboxamide |
| SMILES | N#CCC(=O)N1CCOC[C@@H]1COc1nccc2cc(C(N)=O)c(O)cc12 |
| InChI | InChI=1S/C18H18N4O5/c19-3-1-16(24)22-5-6-26-9-12(22)10-27-18-13-8-15(23)14(17(20)25)7-11(13)2-4-21-18/h2,4,7-8,12,23H,1,5-6,9-10H2,(H2,20,25)/t12-/m1/s1 |
| InChIKey | IREYWDBTHQHAMB-GFCCVEGCSA-N |
| XLogP | 0.56 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |