C19H20N4O5S — CID 142580685
1-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]sulfonyl-7-methoxyisoquinoline-6-carboxamide (PubChem CID 142580685) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is 1-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]sulfonyl-7-methoxyisoquinoline-6-carboxamide.
| Compound Name | 1-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]sulfonyl-7-methoxyisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 142580685 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 1-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]sulfonyl-7-methoxyisoquinoline-6-carboxamide |
| SMILES | COc1cc2c(S(=O)(=O)[C@@H]3CCCN(C(=O)CC#N)C3)nccc2cc1C(N)=O |
| InChI | InChI=1S/C19H20N4O5S/c1-28-16-10-14-12(9-15(16)18(21)25)5-7-22-19(14)29(26,27)13-3-2-8-23(11-13)17(24)4-6-20/h5,7,9-10,13H,2-4,8,11H2,1H3,(H2,21,25)/t13-/m1/s1 |
| InChIKey | KYLKTMLWKLQQNY-CYBMUJFWSA-N |
| XLogP | 1.02 |
| TPSA | 143.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |