C17H18N4O4 — CID 138680023
1-[(3aR,6S,6aR)-6-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-methoxyisoquinoline-6-carboxamide (PubChem CID 138680023) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-[(3aR,6S,6aR)-6-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-methoxyisoquinoline-6-carboxamide.
| Compound Name | 1-[(3aR,6S,6aR)-6-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-methoxyisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 138680023 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[(3aR,6S,6aR)-6-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-methoxyisoquinoline-6-carboxamide |
| SMILES | COc1cc2c(N3C[C@H]4NC(=O)O[C@H]4[C@@H]3C)nccc2cc1C(N)=O |
| InChI | InChI=1S/C17H18N4O4/c1-8-14-12(20-17(23)25-14)7-21(8)16-10-6-13(24-2)11(15(18)22)5-9(10)3-4-19-16/h3-6,8,12,14H,7H2,1-2H3,(H2,18,22)(H,20,23)/t8-,12+,14-/m0/s1 |
| InChIKey | SLDRZUGXHOGBQY-PELMWDNLSA-N |
| XLogP | 1.03 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |