C16H16N4O4 — CID 138680059
1-[(3aR,6aS)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-(trideuteriomethoxy)isoquinoline-6-carboxamide (PubChem CID 138680059) has the molecular formula C16H16N4O4 and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-(trideuteriomethoxy)isoquinoline-6-carboxamide.
| Compound Name | 1-[(3aR,6aS)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-(trideuteriomethoxy)isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 138680059 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[(3aR,6aS)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-(trideuteriomethoxy)isoquinoline-6-carboxamide |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(N3C[C@@H]4OC(=O)N[C@@H]4C3)nccc2cc1C(N)=O |
| InChI | InChI=1S/C16H16N4O4/c1-23-12-5-9-8(4-10(12)14(17)21)2-3-18-15(9)20-6-11-13(7-20)24-16(22)19-11/h2-5,11,13H,6-7H2,1H3,(H2,17,21)(H,19,22)/t11-,13+/m1/s1/i1D3 |
| InChIKey | VIKPRWSZEYYQMJ-STDSIVRGSA-N |
| XLogP | 0.64 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |