C19H20N4O4 — CID 138715525
7-(cyclopropylmethoxy)-1-(2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl)isoquinoline-6-carboxamide (PubChem CID 138715525) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 7-(cyclopropylmethoxy)-1-(2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl)isoquinoline-6-carboxamide.
| Compound Name | 7-(cyclopropylmethoxy)-1-(2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl)isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 138715525 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 7-(cyclopropylmethoxy)-1-(2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl)isoquinoline-6-carboxamide |
| SMILES | NC(=O)c1cc2ccnc(N3CC4NC(=O)OC4C3)c2cc1OCC1CC1 |
| InChI | InChI=1S/C19H20N4O4/c20-17(24)13-5-11-3-4-21-18(12(11)6-15(13)26-9-10-1-2-10)23-7-14-16(8-23)27-19(25)22-14/h3-6,10,14,16H,1-2,7-9H2,(H2,20,24)(H,22,25) |
| InChIKey | SKWIQQKZSXYDNK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |