C18H18N4O3 — CID 138714968
1-[(3aS,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-propan-2-yloxyisoquinoline-6-carbonitrile (PubChem CID 138714968) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-propan-2-yloxyisoquinoline-6-carbonitrile.
| Compound Name | 1-[(3aS,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-propan-2-yloxyisoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 138714968 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[(3aS,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-7-propan-2-yloxyisoquinoline-6-carbonitrile |
| SMILES | CC(C)Oc1cc2c(N3C[C@@H]4NC(=O)O[C@@H]4C3)nccc2cc1C#N |
| InChI | InChI=1S/C18H18N4O3/c1-10(2)24-15-6-13-11(5-12(15)7-19)3-4-20-17(13)22-8-14-16(9-22)25-18(23)21-14/h3-6,10,14,16H,8-9H2,1-2H3,(H,21,23)/t14-,16+/m0/s1 |
| InChIKey | FKBKOQLMNDTTDF-GOEBONIOSA-N |
| XLogP | 2.19 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |