C17H18N4O4 — CID 138679845
4-[(3aS,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-6-ethoxyquinoline-7-carboxamide (PubChem CID 138679845) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 4-[(3aS,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-6-ethoxyquinoline-7-carboxamide.
| Compound Name | 4-[(3aS,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-6-ethoxyquinoline-7-carboxamide |
|---|---|
| PubChem CID | 138679845 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-[(3aS,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-6-ethoxyquinoline-7-carboxamide |
| SMILES | CCOc1cc2c(N3C[C@@H]4NC(=O)O[C@@H]4C3)ccnc2cc1C(N)=O |
| InChI | InChI=1S/C17H18N4O4/c1-2-24-14-6-9-11(5-10(14)16(18)22)19-4-3-13(9)21-7-12-15(8-21)25-17(23)20-12/h3-6,12,15H,2,7-8H2,1H3,(H2,18,22)(H,20,23)/t12-,15+/m0/s1 |
| InChIKey | RSFWOQLWUOTABJ-SWLSCSKDSA-N |
| XLogP | 1.03 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |