C19H26N4O4S — CID 138679948
1-[3-(methanesulfonamido)piperidin-1-yl]-7-propan-2-yloxyisoquinoline-6-carboxamide (PubChem CID 138679948) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-[3-(methanesulfonamido)piperidin-1-yl]-7-propan-2-yloxyisoquinoline-6-carboxamide.
| Compound Name | 1-[3-(methanesulfonamido)piperidin-1-yl]-7-propan-2-yloxyisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 138679948 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-[3-(methanesulfonamido)piperidin-1-yl]-7-propan-2-yloxyisoquinoline-6-carboxamide |
| SMILES | CC(C)Oc1cc2c(N3CCCC(NS(C)(=O)=O)C3)nccc2cc1C(N)=O |
| InChI | InChI=1S/C19H26N4O4S/c1-12(2)27-17-10-15-13(9-16(17)18(20)24)6-7-21-19(15)23-8-4-5-14(11-23)22-28(3,25)26/h6-7,9-10,12,14,22H,4-5,8,11H2,1-3H3,(H2,20,24) |
| InChIKey | QVBYWQGOJYERDE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |