C23H31N3O5 — CID 126573738
butyl 3-(6-carbamoyl-7-propan-2-yloxyisoquinolin-1-yl)oxypiperidine-1-carboxylate (PubChem CID 126573738) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is butyl 3-(6-carbamoyl-7-propan-2-yloxyisoquinolin-1-yl)oxypiperidine-1-carboxylate.
| Compound Name | butyl 3-(6-carbamoyl-7-propan-2-yloxyisoquinolin-1-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 126573738 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | butyl 3-(6-carbamoyl-7-propan-2-yloxyisoquinolin-1-yl)oxypiperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC(Oc2nccc3cc(C(N)=O)c(OC(C)C)cc23)C1 |
| InChI | InChI=1S/C23H31N3O5/c1-4-5-11-29-23(28)26-10-6-7-17(14-26)31-22-18-13-20(30-15(2)3)19(21(24)27)12-16(18)8-9-25-22/h8-9,12-13,15,17H,4-7,10-11,14H2,1-3H3,(H2,24,27) |
| InChIKey | ZHUDWBLAMUWSTR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|