C20H25N3O4 — CID 166972371
1-[(4-ethyl-5-oxopyrrolidin-2-yl)methoxy]-7-propan-2-yloxyisoquinoline-6-carboxamide (PubChem CID 166972371) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[(4-ethyl-5-oxopyrrolidin-2-yl)methoxy]-7-propan-2-yloxyisoquinoline-6-carboxamide.
| Compound Name | 1-[(4-ethyl-5-oxopyrrolidin-2-yl)methoxy]-7-propan-2-yloxyisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 166972371 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[(4-ethyl-5-oxopyrrolidin-2-yl)methoxy]-7-propan-2-yloxyisoquinoline-6-carboxamide |
| SMILES | CCC1CC(COc2nccc3cc(C(N)=O)c(OC(C)C)cc23)NC1=O |
| InChI | InChI=1S/C20H25N3O4/c1-4-12-7-14(23-19(12)25)10-26-20-15-9-17(27-11(2)3)16(18(21)24)8-13(15)5-6-22-20/h5-6,8-9,11-12,14H,4,7,10H2,1-3H3,(H2,21,24)(H,23,25) |
| InChIKey | YARKEZPLUUXNIB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |