C20H22Cl2N4 — CID 134490854
1-[1-(2,4-dichlorophenyl)ethyl]-6-(2-methylpiperazin-1-yl)benzimidazole (PubChem CID 134490854) has the molecular formula C20H22Cl2N4 and a molecular weight of 389.33 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-6-(2-methylpiperazin-1-yl)benzimidazole.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-6-(2-methylpiperazin-1-yl)benzimidazole |
|---|---|
| PubChem CID | 134490854 |
| Molecular Formula | C20H22Cl2N4 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-6-(2-methylpiperazin-1-yl)benzimidazole |
| SMILES | CC1CNCCN1c1ccc2ncn(C(C)c3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C20H22Cl2N4/c1-13-11-23-7-8-25(13)16-4-6-19-20(10-16)26(12-24-19)14(2)17-5-3-15(21)9-18(17)22/h3-6,9-10,12-14,23H,7-8,11H2,1-2H3 |
| InChIKey | RPVQPYGPNLOPDA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |