C15H17Cl2N3 — CID 114717627
1-[1-(2,4-dichlorophenyl)ethyl]-5-pyrrolidin-3-ylimidazole (PubChem CID 114717627) has the molecular formula C15H17Cl2N3 and a molecular weight of 310.23 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-5-pyrrolidin-3-ylimidazole.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-5-pyrrolidin-3-ylimidazole |
|---|---|
| PubChem CID | 114717627 |
| Molecular Formula | C15H17Cl2N3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-5-pyrrolidin-3-ylimidazole |
| SMILES | CC(c1ccc(Cl)cc1Cl)n1cncc1C1CCNC1 |
| InChI | InChI=1S/C15H17Cl2N3/c1-10(13-3-2-12(16)6-14(13)17)20-9-19-8-15(20)11-4-5-18-7-11/h2-3,6,8-11,18H,4-5,7H2,1H3 |
| InChIKey | ZZEKGEWDHWJYGQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |