C14H12F6N2O2 — CID 134491121
(3S,5S,6R)-6-methyl-3-nitroso-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one (PubChem CID 134491121) has the molecular formula C14H12F6N2O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is (3S,5S,6R)-6-methyl-3-nitroso-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one.
| Compound Name | (3S,5S,6R)-6-methyl-3-nitroso-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 134491121 |
| Molecular Formula | C14H12F6N2O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (3S,5S,6R)-6-methyl-3-nitroso-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-2-one |
| SMILES | C[C@@H]1[C@H](c2c(F)ccc(F)c2F)C[C@H](N=O)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C14H12F6N2O2/c1-6-7(11-8(15)2-3-9(16)12(11)17)4-10(21-24)13(23)22(6)5-14(18,19)20/h2-3,6-7,10H,4-5H2,1H3/t6-,7-,10+/m1/s1 |
| InChIKey | JGLIBDWKHNTFDU-XSSZXYGBSA-N |
| XLogP | 3.51 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|