C27H25F8NO4S — CID 134491312
[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-morpholin-4-ylmethanone (PubChem CID 134491312) has the molecular formula C27H25F8NO4S and a molecular weight of 611.55 g/mol. Its IUPAC name is [(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 134491312 |
| Molecular Formula | C27H25F8NO4S |
| Molecular Weight | 611.55 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | [(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12)N1CCOCC1 |
| InChI | InChI=1S/C27H25F8NO4S/c28-18-3-5-19(6-4-18)41(38,39)24-10-9-20(23(37)36-11-13-40-14-12-36)22(24)7-1-16-15-17(2-8-21(16)24)25(29,26(30,31)32)27(33,34)35/h2-6,8,15,20,22H,1,7,9-14H2/t20-,22+,24-/m1/s1 |
| InChIKey | ZIPHIEGSKVZYLM-JCTONOIOSA-N |
| XLogP | 5.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |