C25H23F8NO4S — CID 134491628
(2R)-N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-hydroxypropanamide (PubChem CID 134491628) has the molecular formula C25H23F8NO4S and a molecular weight of 585.51 g/mol. Its IUPAC name is (2R)-N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-hydroxypropanamide.
| Compound Name | (2R)-N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 134491628 |
| Molecular Formula | C25H23F8NO4S |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | (2R)-N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-hydroxypropanamide |
| SMILES | C[C@@H](O)C(=O)N[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C25H23F8NO4S/c1-13(35)21(36)34-20-10-11-22(39(37,38)17-6-4-16(26)5-7-17)18-9-3-15(12-14(18)2-8-19(20)22)23(27,24(28,29)30)25(31,32)33/h3-7,9,12-13,19-20,35H,2,8,10-11H2,1H3,(H,34,36)/t13-,19+,20-,22-/m1/s1 |
| InChIKey | XTDAYXIUIHCDSJ-MGCNMGEWSA-N |
| XLogP | 5.01 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |