C25H30N4O3 — CID 134493078
methyl 3-[2-[6-[[2-[4-(dimethylamino)piperidin-1-yl]acetyl]amino]-3-pyridinyl]ethynyl]-4-methylbenzoate (PubChem CID 134493078) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is methyl 3-[2-[6-[[2-[4-(dimethylamino)piperidin-1-yl]acetyl]amino]-3-pyridinyl]ethynyl]-4-methylbenzoate.
| Compound Name | methyl 3-[2-[6-[[2-[4-(dimethylamino)piperidin-1-yl]acetyl]amino]-3-pyridinyl]ethynyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 134493078 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | methyl 3-[2-[6-[[2-[4-(dimethylamino)piperidin-1-yl]acetyl]amino]-3-pyridinyl]ethynyl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(C#Cc2ccc(NC(=O)CN3CCC(N(C)C)CC3)nc2)c1 |
| InChI | InChI=1S/C25H30N4O3/c1-18-5-8-21(25(31)32-4)15-20(18)9-6-19-7-10-23(26-16-19)27-24(30)17-29-13-11-22(12-14-29)28(2)3/h5,7-8,10,15-16,22H,11-14,17H2,1-4H3,(H,26,27,30) |
| InChIKey | FPJXUSKMERLJIJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|