C17H16ClF3N4O2S — CID 134493655
N-(3-chloropropyl)-2-[3-methyl-2-oxo-6-[5-(trifluoromethyl)thiophen-2-yl]imidazo[4,5-b]pyridin-1-yl]acetamide (PubChem CID 134493655) has the molecular formula C17H16ClF3N4O2S and a molecular weight of 432.86 g/mol. Its IUPAC name is N-(3-chloropropyl)-2-[3-methyl-2-oxo-6-[5-(trifluoromethyl)thiophen-2-yl]imidazo[4,5-b]pyridin-1-yl]acetamide.
| Compound Name | N-(3-chloropropyl)-2-[3-methyl-2-oxo-6-[5-(trifluoromethyl)thiophen-2-yl]imidazo[4,5-b]pyridin-1-yl]acetamide |
|---|---|
| PubChem CID | 134493655 |
| Molecular Formula | C17H16ClF3N4O2S |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N-(3-chloropropyl)-2-[3-methyl-2-oxo-6-[5-(trifluoromethyl)thiophen-2-yl]imidazo[4,5-b]pyridin-1-yl]acetamide |
| SMILES | Cn1c(=O)n(CC(=O)NCCCCl)c2cc(-c3ccc(C(F)(F)F)s3)cnc21 |
| InChI | InChI=1S/C17H16ClF3N4O2S/c1-24-15-11(25(16(24)27)9-14(26)22-6-2-5-18)7-10(8-23-15)12-3-4-13(28-12)17(19,20)21/h3-4,7-8H,2,5-6,9H2,1H3,(H,22,26) |
| InChIKey | OKKBVHGMVXDVQF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|