C28H31N3O4 — CID 134494835
(5R)-5-[4-[4-(5,6-dimethyl-1-benzofuran-3-yl)piperidine-1-carbonyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 134494835) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is (5R)-5-[4-[4-(5,6-dimethyl-1-benzofuran-3-yl)piperidine-1-carbonyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-[4-(5,6-dimethyl-1-benzofuran-3-yl)piperidine-1-carbonyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134494835 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (5R)-5-[4-[4-(5,6-dimethyl-1-benzofuran-3-yl)piperidine-1-carbonyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | Cc1cc2occ(C3CCN(C(=O)c4ccc([C@@]5(C(C)C)NC(=O)NC5=O)cc4)CC3)c2cc1C |
| InChI | InChI=1S/C28H31N3O4/c1-16(2)28(26(33)29-27(34)30-28)21-7-5-20(6-8-21)25(32)31-11-9-19(10-12-31)23-15-35-24-14-18(4)17(3)13-22(23)24/h5-8,13-16,19H,9-12H2,1-4H3,(H2,29,30,33,34)/t28-/m1/s1 |
| InChIKey | ANYAKOMKQYCSLL-MUUNZHRXSA-N |
| XLogP | 4.76 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|