C25H26N4O3S — CID 134494930
5-[4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 134494930) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 5-[4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-[4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134494930 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 5-[4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)C1(c2ccc(C(=O)N3CCC(c4nc5ccccc5s4)CC3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C25H26N4O3S/c1-15(2)25(23(31)27-24(32)28-25)18-9-7-17(8-10-18)22(30)29-13-11-16(12-14-29)21-26-19-5-3-4-6-20(19)33-21/h3-10,15-16H,11-14H2,1-2H3,(H2,27,28,31,32) |
| InChIKey | RCZNXOKKGBSUJI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|