C24H31ClN2O6S — CID 134496446
tert-butyl 2-[2-[5-chloro-2-formyl-N-[(4-methoxyphenyl)methyl]anilino]ethyl-methylsulfonylamino]acetate (PubChem CID 134496446) has the molecular formula C24H31ClN2O6S and a molecular weight of 511.04 g/mol. Its IUPAC name is tert-butyl 2-[2-[5-chloro-2-formyl-N-[(4-methoxyphenyl)methyl]anilino]ethyl-methylsulfonylamino]acetate.
| Compound Name | tert-butyl 2-[2-[5-chloro-2-formyl-N-[(4-methoxyphenyl)methyl]anilino]ethyl-methylsulfonylamino]acetate |
|---|---|
| PubChem CID | 134496446 |
| Molecular Formula | C24H31ClN2O6S |
| Molecular Weight | 511.04 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | tert-butyl 2-[2-[5-chloro-2-formyl-N-[(4-methoxyphenyl)methyl]anilino]ethyl-methylsulfonylamino]acetate |
| SMILES | COc1ccc(CN(CCN(CC(=O)OC(C)(C)C)S(C)(=O)=O)c2cc(Cl)ccc2C=O)cc1 |
| InChI | InChI=1S/C24H31ClN2O6S/c1-24(2,3)33-23(29)16-27(34(5,30)31)13-12-26(15-18-6-10-21(32-4)11-7-18)22-14-20(25)9-8-19(22)17-28/h6-11,14,17H,12-13,15-16H2,1-5H3 |
| InChIKey | NGPJCUMHKIETFA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.04 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|