C17H18ClNO4 — CID 134498061
3,3-dihydroxypropyl 2-(3-chloro-2-methylanilino)benzoate (PubChem CID 134498061) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is 3,3-dihydroxypropyl 2-(3-chloro-2-methylanilino)benzoate.
| Compound Name | 3,3-dihydroxypropyl 2-(3-chloro-2-methylanilino)benzoate |
|---|---|
| PubChem CID | 134498061 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3,3-dihydroxypropyl 2-(3-chloro-2-methylanilino)benzoate |
| SMILES | Cc1c(Cl)cccc1Nc1ccccc1C(=O)OCCC(O)O |
| InChI | InChI=1S/C17H18ClNO4/c1-11-13(18)6-4-8-14(11)19-15-7-3-2-5-12(15)17(22)23-10-9-16(20)21/h2-8,16,19-21H,9-10H2,1H3 |
| InChIKey | QHXDLNYBRJBAAZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|