C23H25F3O7 — CID 134498876
(2S,3R,4R,5S,6R)-2-[5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-methoxy-2-(trifluoromethoxy)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 134498876) has the molecular formula C23H25F3O7 and a molecular weight of 470.44 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-methoxy-2-(trifluoromethoxy)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-methoxy-2-(trifluoromethoxy)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 134498876 |
| Molecular Formula | C23H25F3O7 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-methoxy-2-(trifluoromethoxy)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1cc(OC(F)(F)F)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C23H25F3O7/c1-31-16-9-17(33-23(24,25)26)15(22-21(30)20(29)19(28)18(10-27)32-22)8-14(16)7-11-2-3-12-4-5-13(12)6-11/h2-3,6,8-9,18-22,27-30H,4-5,7,10H2,1H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | UJCWRTFCPXFNSC-BDHVOXNPSA-N |
| XLogP | 1.80 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |