C22H25ClO6 — CID 153285738
(2S,3R,4R,5S,6R)-2-[5-[3-bicyclo[4.2.0]octa-1(6),2,4-trienyl(dideuterio)methyl]-4-chloro-2-methoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 153285738) has the molecular formula C22H25ClO6 and a molecular weight of 422.90 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-[3-bicyclo[4.2.0]octa-1(6),2,4-trienyl(dideuterio)methyl]-4-chloro-2-methoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-[3-bicyclo[4.2.0]octa-1(6),2,4-trienyl(dideuterio)methyl]-4-chloro-2-methoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 153285738 |
| Molecular Formula | C22H25ClO6 |
| Molecular Weight | 422.90 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-[3-bicyclo[4.2.0]octa-1(6),2,4-trienyl(dideuterio)methyl]-4-chloro-2-methoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [2H]C([2H])(c1ccc2c(c1)CC2)c1cc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(OC)cc1Cl |
| InChI | InChI=1S/C22H25ClO6/c1-28-17-9-16(23)14(7-11-2-3-12-4-5-13(12)6-11)8-15(17)22-21(27)20(26)19(25)18(10-24)29-22/h2-3,6,8-9,18-22,24-27H,4-5,7,10H2,1H3/t18-,19-,20+,21-,22+/m1/s1/i7D2 |
| InChIKey | WDOGUZLOANEPGD-TWELEVGESA-N |
| XLogP | 1.55 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.90 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |