C28H37ClO7 — CID 25169246
(2S,3R,4R,5S,6R)-2-[4-chloro-2-(2-cyclopentyloxyethoxy)-5-[(4-ethylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 25169246) has the molecular formula C28H37ClO7 and a molecular weight of 521.05 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-2-(2-cyclopentyloxyethoxy)-5-[(4-ethylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-2-(2-cyclopentyloxyethoxy)-5-[(4-ethylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 25169246 |
| Molecular Formula | C28H37ClO7 |
| Molecular Weight | 521.05 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-2-(2-cyclopentyloxyethoxy)-5-[(4-ethylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OCCOC3CCCC3)cc2Cl)cc1 |
| InChI | InChI=1S/C28H37ClO7/c1-2-17-7-9-18(10-8-17)13-19-14-21(28-27(33)26(32)25(31)24(16-30)36-28)23(15-22(19)29)35-12-11-34-20-5-3-4-6-20/h7-10,14-15,20,24-28,30-33H,2-6,11-13,16H2,1H3/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | QZOFSMLLKMBPFN-DFLSAPQXSA-N |
| XLogP | 3.35 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.05 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|