2,3-bis(sulfanylmethyl)benzoic acid

C9H10O2S2 — CID 134500580

IUPAC2,3-bis(sulfanylmethyl)benzoic acid
SMILESO=C(O)c1cccc(CS)c1CS
InChIInChI=1S/C9H10O2S2/c10-9(11)7-3-1-2-6(4-12)8(7)5-13/h1-3,12-13H,4-5H2,(H,10,11)
InChIKeyLJMJMODOKKJHMD-UHFFFAOYSA-N
MW214.31 g/mol
LogP2.24
Rot. Bonds3

About 2,3-bis(sulfanylmethyl)benzoic acid

2,3-bis(sulfanylmethyl)benzoic acid (PubChem CID 134500580) has the molecular formula C9H10O2S2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,3-bis(sulfanylmethyl)benzoic acid.

Molecular Properties

Compound Name2,3-bis(sulfanylmethyl)benzoic acid
PubChem CID134500580
Molecular FormulaC9H10O2S2
Molecular Weight214.31 g/mol
Exact Mass214.01
IUPAC Name2,3-bis(sulfanylmethyl)benzoic acid
SMILESO=C(O)c1cccc(CS)c1CS
InChIInChI=1S/C9H10O2S2/c10-9(11)7-3-1-2-6(4-12)8(7)5-13/h1-3,12-13H,4-5H2,(H,10,11)
InChIKeyLJMJMODOKKJHMD-UHFFFAOYSA-N
XLogP2.24
TPSA37.30 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.31
LogP ≤ 52.24
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2,3-bis(sulfanylmethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-bis(sulfanylmethyl)benzoic acid?
The IUPAC name of 2,3-bis(sulfanylmethyl)benzoic acid (CID 134500580) is 2,3-bis(sulfanylmethyl)benzoic acid.
What is the SMILES notation for 2,3-bis(sulfanylmethyl)benzoic acid?
The canonical SMILES for 2,3-bis(sulfanylmethyl)benzoic acid is O=C(O)c1cccc(CS)c1CS.
What is the InChIKey of 2,3-bis(sulfanylmethyl)benzoic acid?
The InChIKey is LJMJMODOKKJHMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S2/c10-9(11)7-3-1-2-6(4-12)8(7)5-13/h1-3,12-13H,4-5H2,(H,10,11).
What are the key properties of 2,3-bis(sulfanylmethyl)benzoic acid?
2,3-bis(sulfanylmethyl)benzoic acid has a molecular weight of 214.31 g/mol, XLogP of 2.24, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(sulfanylmethyl)benzoic acid is sourced from PubChem (CID 134500580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).