C32H37N7O2 — CID 134502659
(E)-1-[2-[4-amino-3-(5-phenoxy-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]-6-azaspiro[3.4]octan-6-yl]non-2-en-1-one (PubChem CID 134502659) has the molecular formula C32H37N7O2 and a molecular weight of 551.70 g/mol. Its IUPAC name is (E)-1-[2-[4-amino-3-(5-phenoxy-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]-6-azaspiro[3.4]octan-6-yl]non-2-en-1-one.
| Compound Name | (E)-1-[2-[4-amino-3-(5-phenoxy-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]-6-azaspiro[3.4]octan-6-yl]non-2-en-1-one |
|---|---|
| PubChem CID | 134502659 |
| Molecular Formula | C32H37N7O2 |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | (E)-1-[2-[4-amino-3-(5-phenoxy-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]-6-azaspiro[3.4]octan-6-yl]non-2-en-1-one |
| SMILES | CCCCCC/C=C/C(=O)N1CCC2(CC(n3nc(-c4ccc(Oc5ccccc5)cn4)c4c(N)ncnc43)C2)C1 |
| InChI | InChI=1S/C32H37N7O2/c1-2-3-4-5-6-10-13-27(40)38-17-16-32(21-38)18-23(19-32)39-31-28(30(33)35-22-36-31)29(37-39)26-15-14-25(20-34-26)41-24-11-8-7-9-12-24/h7-15,20,22-23H,2-6,16-19,21H2,1H3,(H2,33,35,36)/b13-10+ |
| InChIKey | NDUNAFYUNFJCDB-JLHYYAGUSA-N |
| XLogP | 6.34 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|