C25H23N7O2 — CID 123161890
1-[4-[4-amino-3-(5-phenoxy-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]but-2-yn-1-one (PubChem CID 123161890) has the molecular formula C25H23N7O2 and a molecular weight of 453.51 g/mol. Its IUPAC name is 1-[4-[4-amino-3-(5-phenoxy-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[4-[4-amino-3-(5-phenoxy-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 123161890 |
| Molecular Formula | C25H23N7O2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-[4-[4-amino-3-(5-phenoxy-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCC(n2nc(-c3ccc(Oc4ccccc4)cn3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C25H23N7O2/c1-2-6-21(33)31-13-11-17(12-14-31)32-25-22(24(26)28-16-29-25)23(30-32)20-10-9-19(15-27-20)34-18-7-4-3-5-8-18/h3-5,7-10,15-17H,11-14H2,1H3,(H2,26,28,29) |
| InChIKey | PWHXIUFAKPLZPH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|