C24H22F2IN5O2 — CID 134504059
4-[3-amino-6-(6-oxopiperidin-3-yl)pyrazin-2-yl]-2-fluoro-N-[(1R)-1-(3-fluoro-5-iodophenyl)ethyl]benzamide (PubChem CID 134504059) has the molecular formula C24H22F2IN5O2 and a molecular weight of 577.37 g/mol. Its IUPAC name is 4-[3-amino-6-(6-oxopiperidin-3-yl)pyrazin-2-yl]-2-fluoro-N-[(1R)-1-(3-fluoro-5-iodophenyl)ethyl]benzamide.
| Compound Name | 4-[3-amino-6-(6-oxopiperidin-3-yl)pyrazin-2-yl]-2-fluoro-N-[(1R)-1-(3-fluoro-5-iodophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 134504059 |
| Molecular Formula | C24H22F2IN5O2 |
| Molecular Weight | 577.37 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | 4-[3-amino-6-(6-oxopiperidin-3-yl)pyrazin-2-yl]-2-fluoro-N-[(1R)-1-(3-fluoro-5-iodophenyl)ethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(-c2nc(C3CCC(=O)NC3)cnc2N)cc1F)c1cc(F)cc(I)c1 |
| InChI | InChI=1S/C24H22F2IN5O2/c1-12(15-6-16(25)9-17(27)7-15)31-24(34)18-4-2-13(8-19(18)26)22-23(28)30-11-20(32-22)14-3-5-21(33)29-10-14/h2,4,6-9,11-12,14H,3,5,10H2,1H3,(H2,28,30)(H,29,33)(H,31,34)/t12-,14?/m1/s1 |
| InChIKey | UMGMIXFKNBUXAP-PUODRLBUSA-N |
| XLogP | 4.09 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|