C15H16F4N4O — CID 134508377
5-amino-3-ethyl-1-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]pyrazole-4-carboxamide (PubChem CID 134508377) has the molecular formula C15H16F4N4O and a molecular weight of 344.31 g/mol. Its IUPAC name is 5-amino-3-ethyl-1-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-ethyl-1-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134508377 |
| Molecular Formula | C15H16F4N4O |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5-amino-3-ethyl-1-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]pyrazole-4-carboxamide |
| SMILES | CCc1nn(C(C)c2ccc(C(F)(F)F)cc2F)c(N)c1C(N)=O |
| InChI | InChI=1S/C15H16F4N4O/c1-3-11-12(14(21)24)13(20)23(22-11)7(2)9-5-4-8(6-10(9)16)15(17,18)19/h4-7H,3,20H2,1-2H3,(H2,21,24) |
| InChIKey | NMFFMRHRSROAKR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |