C26H24N6O3 — CID 134508606
N-[3-[[6-[4-(morpholine-4-carbonyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 134508606) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is N-[3-[[6-[4-(morpholine-4-carbonyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[6-[4-(morpholine-4-carbonyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134508606 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-[3-[[6-[4-(morpholine-4-carbonyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2ncnc3[nH]c(-c4ccc(C(=O)N5CCOCC5)cc4)cc23)c1 |
| InChI | InChI=1S/C26H24N6O3/c1-2-23(33)29-19-4-3-5-20(14-19)30-24-21-15-22(31-25(21)28-16-27-24)17-6-8-18(9-7-17)26(34)32-10-12-35-13-11-32/h2-9,14-16H,1,10-13H2,(H,29,33)(H2,27,28,30,31) |
| InChIKey | QRKKSYSDRYFFJR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|