C7H15N — CID 134511668
N-ethenyl-N,2-dimethylpropan-1-amine (PubChem CID 134511668) has the molecular formula C7H15N and a molecular weight of 113.20 g/mol. Its IUPAC name is N-ethenyl-N,2-dimethylpropan-1-amine.
| Compound Name | N-ethenyl-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 134511668 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | N-ethenyl-N,2-dimethylpropan-1-amine |
| SMILES | C=CN(C)CC(C)C |
| InChI | InChI=1S/C7H15N/c1-5-8(4)6-7(2)3/h5,7H,1,6H2,2-4H3 |
| InChIKey | VSCSDGQSSJNPSD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |