About N-ethenyl-N-methylpropa-1,2-dien-1-amine
N-ethenyl-N-methylpropa-1,2-dien-1-amine (PubChem CID 139243672) has the molecular formula C6H9N
and a molecular weight of 95.15 g/mol. Its IUPAC name is N-ethenyl-N-methylpropa-1,2-dien-1-amine.
Molecular Properties
| Compound Name | N-ethenyl-N-methylpropa-1,2-dien-1-amine |
| PubChem CID | 139243672 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.15 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | N-ethenyl-N-methylpropa-1,2-dien-1-amine |
| SMILES | C=C=CN(C)C=C |
| InChI | InChI=1S/C6H9N/c1-4-6-7(3)5-2/h5-6H,1-2H2,3H3 |
| InChIKey | UHZFXVJYIRFDNV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethenyl-N-methylpropa-1,2-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N-methylpropa-1,2-dien-1-amine?
The IUPAC name of N-ethenyl-N-methylpropa-1,2-dien-1-amine (CID 139243672) is N-ethenyl-N-methylpropa-1,2-dien-1-amine.
What is the SMILES notation for N-ethenyl-N-methylpropa-1,2-dien-1-amine?
The canonical SMILES for N-ethenyl-N-methylpropa-1,2-dien-1-amine is C=C=CN(C)C=C.
What is the InChIKey of N-ethenyl-N-methylpropa-1,2-dien-1-amine?
The InChIKey is UHZFXVJYIRFDNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N/c1-4-6-7(3)5-2/h5-6H,1-2H2,3H3.
What are the key properties of N-ethenyl-N-methylpropa-1,2-dien-1-amine?
N-ethenyl-N-methylpropa-1,2-dien-1-amine has a molecular weight of 95.15 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-methylpropa-1,2-dien-1-amine is sourced from PubChem (CID 139243672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).