About N,N-dimethylethenamine
N,N-dimethylethenamine (PubChem CID 521812) has the molecular formula C4H9N
and a molecular weight of 71.12 g/mol. Its IUPAC name is N,N-dimethylethenamine.
Molecular Properties
| Compound Name | N,N-dimethylethenamine |
| PubChem CID | 521812 |
| Molecular Formula | C4H9N |
| Molecular Weight | 71.12 g/mol |
| Exact Mass | 71.07 |
| IUPAC Name | N,N-dimethylethenamine |
| SMILES | C=CN(C)C |
| InChI | InChI=1S/C4H9N/c1-4-5(2)3/h4H,1H2,2-3H3 |
| InChIKey | NINOYJQVULROET-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 71.12 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethenamine?
The IUPAC name of N,N-dimethylethenamine (CID 521812) is N,N-dimethylethenamine.
What is the SMILES notation for N,N-dimethylethenamine?
The canonical SMILES for N,N-dimethylethenamine is C=CN(C)C.
What is the InChIKey of N,N-dimethylethenamine?
The InChIKey is NINOYJQVULROET-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N/c1-4-5(2)3/h4H,1H2,2-3H3.
What are the key properties of N,N-dimethylethenamine?
N,N-dimethylethenamine has a molecular weight of 71.12 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethenamine is sourced from PubChem (CID 521812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).