C29H33FN6S — CID 134513968
2-[4-[[5-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]sulfanyl-2,4-dimethylphenyl]methyl]piperazin-1-yl]benzonitrile (PubChem CID 134513968) has the molecular formula C29H33FN6S and a molecular weight of 516.69 g/mol. Its IUPAC name is 2-[4-[[5-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]sulfanyl-2,4-dimethylphenyl]methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-[[5-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]sulfanyl-2,4-dimethylphenyl]methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 134513968 |
| Molecular Formula | C29H33FN6S |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 2-[4-[[5-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]sulfanyl-2,4-dimethylphenyl]methyl]piperazin-1-yl]benzonitrile |
| SMILES | Cc1cc(C)c(SN2CCN(c3ccc(F)cn3)CC2)cc1CN1CCN(c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C29H33FN6S/c1-22-17-23(2)28(37-36-15-13-35(14-16-36)29-8-7-26(30)20-32-29)18-25(22)21-33-9-11-34(12-10-33)27-6-4-3-5-24(27)19-31/h3-8,17-18,20H,9-16,21H2,1-2H3 |
| InChIKey | ZUCMFXJKZHYBKJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|