C28H29ClFN7 — CID 142349166
2-[4-[[4-chloro-3-[4-(5-fluoro-2-pyridinyl)piperazine-1-carboximidoyl]phenyl]methyl]piperazin-1-yl]benzonitrile (PubChem CID 142349166) has the molecular formula C28H29ClFN7 and a molecular weight of 518.04 g/mol. Its IUPAC name is 2-[4-[[4-chloro-3-[4-(5-fluoro-2-pyridinyl)piperazine-1-carboximidoyl]phenyl]methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-[[4-chloro-3-[4-(5-fluoro-2-pyridinyl)piperazine-1-carboximidoyl]phenyl]methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 142349166 |
| Molecular Formula | C28H29ClFN7 |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-[4-[[4-chloro-3-[4-(5-fluoro-2-pyridinyl)piperazine-1-carboximidoyl]phenyl]methyl]piperazin-1-yl]benzonitrile |
| SMILES | [H]/N=C(/c1cc(CN2CCN(c3ccccc3C#N)CC2)ccc1Cl)N1CCN(c2ccc(F)cn2)CC1 |
| InChI | InChI=1S/C28H29ClFN7/c29-25-7-5-21(20-34-9-11-35(12-10-34)26-4-2-1-3-22(26)18-31)17-24(25)28(32)37-15-13-36(14-16-37)27-8-6-23(30)19-33-27/h1-8,17,19,32H,9-16,20H2/b32-28- |
| InChIKey | BNLSVFLDUPWOEC-BLCKFSMSSA-N |
| XLogP | 4.22 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|