C22H22FN3O2S — CID 134514722
5-[5-amino-2-(4-fluorobenzoyl)-4-methylphenyl]-1-methyl-4-[1-(sulfanylamino)ethyl]pyridin-2-one (PubChem CID 134514722) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is 5-[5-amino-2-(4-fluorobenzoyl)-4-methylphenyl]-1-methyl-4-[1-(sulfanylamino)ethyl]pyridin-2-one.
| Compound Name | 5-[5-amino-2-(4-fluorobenzoyl)-4-methylphenyl]-1-methyl-4-[1-(sulfanylamino)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 134514722 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 5-[5-amino-2-(4-fluorobenzoyl)-4-methylphenyl]-1-methyl-4-[1-(sulfanylamino)ethyl]pyridin-2-one |
| SMILES | Cc1cc(C(=O)c2ccc(F)cc2)c(-c2cn(C)c(=O)cc2C(C)NS)cc1N |
| InChI | InChI=1S/C22H22FN3O2S/c1-12-8-18(22(28)14-4-6-15(23)7-5-14)17(9-20(12)24)19-11-26(3)21(27)10-16(19)13(2)25-29/h4-11,13,25,29H,24H2,1-3H3 |
| InChIKey | UQPVEHICMCVWRP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|