C13H25N3O2S — CID 134515016
N-[4-(morpholin-4-ylmethyl)-1-sulfanylpiperidin-4-yl]propanamide (PubChem CID 134515016) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[4-(morpholin-4-ylmethyl)-1-sulfanylpiperidin-4-yl]propanamide.
| Compound Name | N-[4-(morpholin-4-ylmethyl)-1-sulfanylpiperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 134515016 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[4-(morpholin-4-ylmethyl)-1-sulfanylpiperidin-4-yl]propanamide |
| SMILES | CCC(=O)NC1(CN2CCOCC2)CCN(S)CC1 |
| InChI | InChI=1S/C13H25N3O2S/c1-2-12(17)14-13(3-5-16(19)6-4-13)11-15-7-9-18-10-8-15/h19H,2-11H2,1H3,(H,14,17) |
| InChIKey | YGBNCZQQCDOHIA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|