C13H22F3N3O2S2 — CID 134557478
N-[1-(disulfanyl)-4-(morpholin-4-ylmethyl)piperidin-4-yl]-3,3,3-trifluoropropanamide (PubChem CID 134557478) has the molecular formula C13H22F3N3O2S2 and a molecular weight of 373.47 g/mol. Its IUPAC name is N-[1-(disulfanyl)-4-(morpholin-4-ylmethyl)piperidin-4-yl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[1-(disulfanyl)-4-(morpholin-4-ylmethyl)piperidin-4-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 134557478 |
| Molecular Formula | C13H22F3N3O2S2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[1-(disulfanyl)-4-(morpholin-4-ylmethyl)piperidin-4-yl]-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)NC1(CN2CCOCC2)CCN(SS)CC1 |
| InChI | InChI=1S/C13H22F3N3O2S2/c14-13(15,16)9-11(20)17-12(1-3-19(23-22)4-2-12)10-18-5-7-21-8-6-18/h22H,1-10H2,(H,17,20) |
| InChIKey | ZZEGCRHXZHBJBV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|