C9H12F3NO4 — CID 71222479
4-(3,3,3-trifluoropropanoylamino)oxane-4-carboxylic acid (PubChem CID 71222479) has the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropanoylamino)oxane-4-carboxylic acid.
| Compound Name | 4-(3,3,3-trifluoropropanoylamino)oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 71222479 |
| Molecular Formula | C9H12F3NO4 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-(3,3,3-trifluoropropanoylamino)oxane-4-carboxylic acid |
| SMILES | O=C(CC(F)(F)F)NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C9H12F3NO4/c10-9(11,12)5-6(14)13-8(7(15)16)1-3-17-4-2-8/h1-5H2,(H,13,14)(H,15,16) |
| InChIKey | IEELUYOJPXMODB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |