C16H23N3O — CID 134515429
(1,4-dimethylpyrrol-2-yl)-[4-[(2E)-penta-2,4-dien-2-yl]piperazin-1-yl]methanone (PubChem CID 134515429) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is (1,4-dimethylpyrrol-2-yl)-[4-[(2E)-penta-2,4-dien-2-yl]piperazin-1-yl]methanone.
| Compound Name | (1,4-dimethylpyrrol-2-yl)-[4-[(2E)-penta-2,4-dien-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134515429 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (1,4-dimethylpyrrol-2-yl)-[4-[(2E)-penta-2,4-dien-2-yl]piperazin-1-yl]methanone |
| SMILES | C=C/C=C(\C)N1CCN(C(=O)c2cc(C)cn2C)CC1 |
| InChI | InChI=1S/C16H23N3O/c1-5-6-14(3)18-7-9-19(10-8-18)16(20)15-11-13(2)12-17(15)4/h5-6,11-12H,1,7-10H2,2-4H3/b14-6+ |
| InChIKey | DXAXDJYLHBGPRP-MKMNVTDBSA-N |
| XLogP | 2.18 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|