C9H16N2O — CID 134517820
1-[(2R)-2,4-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 134517820) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-[(2R)-2,4-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-2,4-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134517820 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-[(2R)-2,4-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C)C[C@H]1C |
| InChI | InChI=1S/C9H16N2O/c1-4-9(12)11-6-5-10(3)7-8(11)2/h4,8H,1,5-7H2,2-3H3/t8-/m1/s1 |
| InChIKey | KQSAENHOFHWAIJ-MRVPVSSYSA-N |
| XLogP | 0.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|