C14H24O7 — CID 134517824
3-methylbut-2-enyl 2-[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoate (PubChem CID 134517824) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-methylbut-2-enyl 2-[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoate.
| Compound Name | 3-methylbut-2-enyl 2-[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 134517824 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-methylbut-2-enyl 2-[(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoate |
| SMILES | CC(C)=CCOC(=O)C(C)C1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H24O7/c1-7(2)4-5-20-14(19)8(3)13-12(18)11(17)10(16)9(6-15)21-13/h4,8-13,15-18H,5-6H2,1-3H3/t8?,9-,10+,11+,12-,13?/m1/s1 |
| InChIKey | VPBLTIYCEBKDRP-NREUHGNKSA-N |
| XLogP | -1.03 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|