C26H29N5O3S — CID 134517881
1-[4-[2-methoxy-4-methyl-5-[1-[2-(pyridin-2-ylamino)-1,3-thiazol-5-yl]ethyl]benzoyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 134517881) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is 1-[4-[2-methoxy-4-methyl-5-[1-[2-(pyridin-2-ylamino)-1,3-thiazol-5-yl]ethyl]benzoyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-methoxy-4-methyl-5-[1-[2-(pyridin-2-ylamino)-1,3-thiazol-5-yl]ethyl]benzoyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134517881 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 1-[4-[2-methoxy-4-methyl-5-[1-[2-(pyridin-2-ylamino)-1,3-thiazol-5-yl]ethyl]benzoyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)c2cc(C(C)c3cnc(Nc4ccccn4)s3)c(C)cc2OC)CC1 |
| InChI | InChI=1S/C26H29N5O3S/c1-5-24(32)30-10-12-31(13-11-30)25(33)20-15-19(17(2)14-21(20)34-4)18(3)22-16-28-26(35-22)29-23-8-6-7-9-27-23/h5-9,14-16,18H,1,10-13H2,2-4H3,(H,27,28,29) |
| InChIKey | XVAIHIHLBYSPCM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|