About 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine
2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 134518076) has the molecular formula C8H17N5
and a molecular weight of 183.26 g/mol. Its IUPAC name is 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine |
| PubChem CID | 134518076 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1cc(N(C)N)cn1 |
| InChI | InChI=1S/C8H17N5/c1-11(2)4-5-13-7-8(6-10-13)12(3)9/h6-7H,4-5,9H2,1-3H3 |
| InChIKey | LMKJIXRKFSEFDL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine (CID 134518076) is 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine is CN(C)CCn1cc(N(C)N)cn1.
What is the InChIKey of 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine?
The InChIKey is LMKJIXRKFSEFDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N5/c1-11(2)4-5-13-7-8(6-10-13)12(3)9/h6-7H,4-5,9H2,1-3H3.
What are the key properties of 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine?
2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine has a molecular weight of 183.26 g/mol, XLogP of -0.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 134518076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).