C8H17N5 — CID 134518076
2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 134518076) has the molecular formula C8H17N5 and a molecular weight of 183.26 g/mol. Its IUPAC name is 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 134518076 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | 2-[4-[amino(methyl)amino]pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1cc(N(C)N)cn1 |
| InChI | InChI=1S/C8H17N5/c1-11(2)4-5-13-7-8(6-10-13)12(3)9/h6-7H,4-5,9H2,1-3H3 |
| InChIKey | LMKJIXRKFSEFDL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|