C9H18N4O — CID 62332870
1-[2-(4-aminopyrazol-1-yl)ethyl-methylamino]propan-2-ol (PubChem CID 62332870) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-[2-(4-aminopyrazol-1-yl)ethyl-methylamino]propan-2-ol.
| Compound Name | 1-[2-(4-aminopyrazol-1-yl)ethyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 62332870 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 1-[2-(4-aminopyrazol-1-yl)ethyl-methylamino]propan-2-ol |
| SMILES | CC(O)CN(C)CCn1cc(N)cn1 |
| InChI | InChI=1S/C9H18N4O/c1-8(14)6-12(2)3-4-13-7-9(10)5-11-13/h5,7-8,14H,3-4,6,10H2,1-2H3 |
| InChIKey | SZBYVYNSDNKTKA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |